Difference between revisions of "CPD-9859"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11361 RXN-11361] == * direction: ** left-to-right * common-name: ** molybdopterin-synthase aden...")
(Created page with "Category:metabolite == Metabolite CPD-9859 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11361 RXN-11361] ==
+
== Metabolite CPD-9859 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** molybdopterin-synthase adenylyltransferase
+
** 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.7.7.80 ec-2.7.7.80]
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c
== Reaction formula ==
+
* inchi-key:
* 1 [[ATP]][c] '''+''' 1 [[MPT-Synthase-small-subunits]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[Carboxyadenylated-MPT-synthases]][c] '''+''' 1 [[PPI]][c]
+
** rohkdmwqxdhldy-hohoqcmasa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ12357]]
+
** 630.993
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ06337]]
+
* [[RXN-9227]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=rohkdmwqxdhldy-hohoqcmasa-n}}
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=630.993}}
== Pathway(s) ==
 
* [[PWY-6823]], molybdenum cofactor biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6823 PWY-6823]
 
** '''7''' reactions found over '''8''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=43617 43617]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=molybdopterin-synthase adenylyltransferase}}
 
{{#set: ec-number=ec-2.7.7.80}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-9859

  • common-name:
    • 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c
  • inchi-key:
    • rohkdmwqxdhldy-hohoqcmasa-n
  • molecular-weight:
    • 630.993

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality