Difference between revisions of "CPD-14950"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE-TRANSAMINE-RXN PREPHENATE-TRANSAMINE-RXN] == * direction: ** reversible * common-name: *...") |
(Created page with "Category:metabolite == Metabolite CPD-14950 == * common-name: ** 3-o-methylkaempferol * smiles: ** coc3(c(=o)c1(c(=cc(o)=cc(o)=1)oc(c2(c=cc(o)=cc=2))=3)) * inchi-key: ** v...") |
||
| (7 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-14950 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 3-o-methylkaempferol |
| − | * | + | * smiles: |
| − | ** | + | ** coc3(c(=o)c1(c(=cc(o)=cc(o)=1)oc(c2(c=cc(o)=cc=2))=3)) |
| − | == | + | * inchi-key: |
| − | + | ** vjjzjbucdwkplc-uhfffaoysa-n | |
| − | == | + | * molecular-weight: |
| − | * | + | ** 300.267 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | == Reaction(s) known to produce the compound == |
| − | == | + | * [[RXN-13935]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=3-o-methylkaempferol}} | |
| − | + | {{#set: inchi-key=inchikey=vjjzjbucdwkplc-uhfffaoysa-n}} | |
| − | + | {{#set: molecular-weight=300.267}} | |
| − | |||
| − | |||
| − | |||
| − | * | ||
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: common-name= | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-14950
- common-name:
- 3-o-methylkaempferol
- smiles:
- coc3(c(=o)c1(c(=cc(o)=cc(o)=1)oc(c2(c=cc(o)=cc=2))=3))
- inchi-key:
- vjjzjbucdwkplc-uhfffaoysa-n
- molecular-weight:
- 300.267
