Difference between revisions of "L-1-GLYCERO-PHOSPHORYLCHOLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-151 RXN1F-151] == * direction: ** left-to-right * common-name: ** γ-carotene β-cyc...")
(Created page with "Category:metabolite == Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE == * common-name: ** sn-glycero-3-phosphocholine * smiles: ** c([n+](c)(c)c)cop([o-])(=o)occ(o)co * inchi-k...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-151 RXN1F-151] ==
+
== Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** γ-carotene β-cyclase
+
** sn-glycero-3-phosphocholine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/5.5.1.19 ec-5.5.1.19]
+
** c([n+](c)(c)c)cop([o-])(=o)occ(o)co
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD1F-126]][c] '''=>''' 1 [[CPD1F-129]][c]
+
** suhoquvvvlnyqr-mrvpvssysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ04962]]
+
** 257.223
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
* [[LYSOPHOSPHOLIPASE-RXN]]
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=sn-glycero-3-phosphocholine}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=suhoquvvvlnyqr-mrvpvssysa-n}}
−
== Pathway(s) ==
+
{{#set: molecular-weight=257.223}}
−
* [[PWY-7938]], isorenieratene biosynthesis I (actinobacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7938 PWY-7938]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5943]], β-carotene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5943 PWY-5943]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32242 32242]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R03824 R03824]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=γ-carotene β-cyclase}}
 
−
{{#set: ec-number=ec-5.5.1.19}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_nannochloropsis_salina|saccharina_japonica_genome|output_pantograph_arabidopsis_thaliana}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE

  • common-name:
    • sn-glycero-3-phosphocholine
  • smiles:
    • c([n+](c)(c)c)cop([o-])(=o)occ(o)co
  • inchi-key:
    • suhoquvvvlnyqr-mrvpvssysa-n
  • molecular-weight:
    • 257.223

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=L-1-GLYCERO-PHOSPHORYLCHOLINE&oldid=139086"