Difference between revisions of "CPD-4207"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-ARGININE-DEIMINASE-RXN PROTEIN-ARGININE-DEIMINASE-RXN] == * direction: ** left-to-right * c...")
(Created page with "Category:metabolite == Metabolite CPD-4207 == * common-name: ** isopentenyl adenosine * smiles: ** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23)) * inchi-key: ** usvm...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-ARGININE-DEIMINASE-RXN PROTEIN-ARGININE-DEIMINASE-RXN] ==
+
== Metabolite CPD-4207 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** protein-arginine deiminase
+
** isopentenyl adenosine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.5.3.15 ec-3.5.3.15]
+
** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Protein-L-Arginines]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[PROTEIN-L-CITRULLINE]][c]
+
** usvmjsalorzvdv-sdbhatresa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ16434]]
+
** 335.362
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-4315]]
−
** Category: [[orthology]]
+
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-4921]], protein citrullination: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4921 PWY-4921]
+
* [[RXN-4315]]
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
−
== Reconstruction information  ==
+
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=isopentenyl adenosine}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=usvmjsalorzvdv-sdbhatresa-n}}
−
* RHEA:
+
{{#set: molecular-weight=335.362}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18090 18090]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R02621 R02621]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/Q08642 Q08642]
 
−
** [http://www.uniprot.org/uniprot/P20717 P20717]
 
−
** [http://www.uniprot.org/uniprot/P70708 P70708]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=protein-arginine deiminase}}
 
−
{{#set: ec-number=ec-3.5.3.15}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-4207

  • common-name:
    • isopentenyl adenosine
  • smiles:
    • cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23))
  • inchi-key:
    • usvmjsalorzvdv-sdbhatresa-n
  • molecular-weight:
    • 335.362

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-4207&oldid=139175"