Difference between revisions of "CPD-4207"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-ARGININE-DEIMINASE-RXN PROTEIN-ARGININE-DEIMINASE-RXN] == * direction: ** left-to-right * c...") |
(Created page with "Category:metabolite == Metabolite CPD-4207 == * common-name: ** isopentenyl adenosine * smiles: ** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23)) * inchi-key: ** usvm...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-4207 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** isopentenyl adenosine |
− | * | + | * smiles: |
− | ** | + | ** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23)) |
− | == | + | * inchi-key: |
− | + | ** usvmjsalorzvdv-sdbhatresa-n | |
− | == | + | * molecular-weight: |
− | * | + | ** 335.362 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-4315]] | |
− | * | + | * [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]] |
− | ** | + | * [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[RXN-4315]] |
− | * | + | * [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]] |
− | + | * [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=isopentenyl adenosine}} | |
− | == | + | {{#set: inchi-key=inchikey=usvmjsalorzvdv-sdbhatresa-n}} |
− | * | + | {{#set: molecular-weight=335.362}} |
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-4207
- common-name:
- isopentenyl adenosine
- smiles:
- cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23))
- inchi-key:
- usvmjsalorzvdv-sdbhatresa-n
- molecular-weight:
- 335.362
Reaction(s) known to consume the compound
- RXN-4315
- RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.
- RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.
Reaction(s) known to produce the compound
- RXN-4315
- RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.
- RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.