Difference between revisions of "CPD-9612"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1321 RXN-1321] == * direction: ** left-to-right * common-name: ** linoleate 13s-lipoxygenase *...")
(Created page with "Category:metabolite == Metabolite CPD-9612 == * common-name: ** caldariellaquinone * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(=c(sc)c(=o)c1(=c(sc=c1)c(=o)2)...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1321 RXN-1321] ==
+
== Metabolite CPD-9612 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** linoleate 13s-lipoxygenase
+
** caldariellaquinone
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.13.11.12 ec-1.13.11.12]
+
** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(=c(sc)c(=o)c1(=c(sc=c1)c(=o)2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[LINOLENIC_ACID]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-725]][c]
+
** ghrwxpxobgrshg-uhfffaoysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 631.069
−
* Gene: [[SJ21863]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[orthology]]
+
* [[RXN-15378]]
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ05859]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=caldariellaquinone}}
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=ghrwxpxobgrshg-uhfffaoysa-n}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=631.069}}
−
* Gene: [[SJ08291]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ08276]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ21862]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ05858]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ21859]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ16634]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ16632]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ16633]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ03316]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ12567]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
* [[PWY-5410]], traumatin and (Z)-3-hexen-1-yl acetate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5410 PWY-5410]
 
−
** '''2''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-735]], jasmonic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735]
 
−
** '''16''' reactions found over '''19''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=34496 34496]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07869 R07869]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=linoleate 13s-lipoxygenase}}
 
−
{{#set: ec-number=ec-1.13.11.12}}
 
−
{{#set: nb gene associated=12}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_arabidopsis_thaliana}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-9612

  • common-name:
    • caldariellaquinone
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(=c(sc)c(=o)c1(=c(sc=c1)c(=o)2))
  • inchi-key:
    • ghrwxpxobgrshg-uhfffaoysa-n
  • molecular-weight:
    • 631.069

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-9612&oldid=139213"