Difference between revisions of "OXALO-SUCCINATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.1.3.17-RXN 4.1.3.17-RXN] == * direction: ** left-to-right * common-name: ** 4-hydroxy-4-methyl-2-...")
(Created page with "Category:metabolite == Metabolite OXALO-SUCCINATE == * common-name: ** oxalosuccinate * smiles: ** c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o * inchi-key: ** ufscuaxltrfidc-uh...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.1.3.17-RXN 4.1.3.17-RXN] ==
+
== Metabolite OXALO-SUCCINATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 4-hydroxy-4-methyl-2-oxoglutarate aldolase
+
** oxalosuccinate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.1.3.17 ec-4.1.3.17]
+
** c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 2 [[PYRUVATE]][c] '''=>''' 1 [[CPD-187]][c]
+
** ufscuaxltrfidc-uhfffaoysa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ13180]]
+
** 187.085
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-8642]]
−
== Pathway(s) ==
+
* [[RXN-9951]]
−
* [[PWY-7701]], 4-hydroxy-4-methyl-L-glutamate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7701 PWY-7701]
+
== Reaction(s) known to produce the compound ==
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-8642]]
−
== Reconstruction information  ==
+
* [[RXN-9951]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=oxalosuccinate}}
−
* RHEA:
+
{{#set: inchi-key=inchikey=ufscuaxltrfidc-uhfffaoysa-k}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22751 22751]
+
{{#set: molecular-weight=187.085}}
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R00008 R00008]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=4-hydroxy-4-methyl-2-oxoglutarate aldolase}}
 
−
{{#set: ec-number=ec-4.1.3.17}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite OXALO-SUCCINATE

  • common-name:
    • oxalosuccinate
  • smiles:
    • c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o
  • inchi-key:
    • ufscuaxltrfidc-uhfffaoysa-k
  • molecular-weight:
    • 187.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=OXALO-SUCCINATE&oldid=139234"