Difference between revisions of "CPD-10608"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRNA-CYTIDYLYLTRANSFERASE-RXN TRNA-CYTIDYLYLTRANSFERASE-RXN] == * direction: ** left-to-right * com...")
(Created page with "Category:metabolite == Metabolite CPD-10608 == * common-name: ** trans-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[o-])1) * inchi-key: ** ayfxpgxazmfwnh-onegzznksa-m *...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRNA-CYTIDYLYLTRANSFERASE-RXN TRNA-CYTIDYLYLTRANSFERASE-RXN] ==
+
== Metabolite CPD-10608 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** trna adenylyl-/cytidylyl-transferase
+
** trans-dienelactone
−
** ctp:trna cytidylyltransferase
+
* smiles:
−
* ec-number:
+
** c1(=cc(=o)oc(=cc(=o)[o-])1)
−
** [http://enzyme.expasy.org/EC/2.7.7.72 ec-2.7.7.72]
+
* inchi-key:
−
== Reaction formula ==
+
** ayfxpgxazmfwnh-onegzznksa-m
−
* 1 [[ATP]][c] '''+''' 2 [[CTP]][c] '''+''' 1 [[tRNA-precursors]][c] '''=>''' 3 [[PPI]][c] '''+''' 1 [[tRNAs-with-CCA]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 139.087
−
* Gene: [[SJ20164]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN-9868]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ20166]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=trans-dienelactone}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-onegzznksa-m}}
−
== Pathway(s) ==
+
{{#set: molecular-weight=139.087}}
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14434 14434]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R09382 R09382]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=trna adenylyl-/cytidylyl-transferase|ctp:trna cytidylyltransferase}}
 
−
{{#set: ec-number=ec-2.7.7.72}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-10608

  • common-name:
    • trans-dienelactone
  • smiles:
    • c1(=cc(=o)oc(=cc(=o)[o-])1)
  • inchi-key:
    • ayfxpgxazmfwnh-onegzznksa-m
  • molecular-weight:
    • 139.087

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-10608&oldid=139239"