Difference between revisions of "PYRIDOXINE-5P"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.3.67-RXN 3.1.3.67-RXN] == * direction: ** left-to-right * common-name: ** phosphatidylinositol-...") |
(Created page with "Category:metabolite == Metabolite PYRIDOXINE-5P == * common-name: ** pyridoxine 5'-phosphate * smiles: ** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co) * inchi-key: ** whomfkwh...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite PYRIDOXINE-5P == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** pyridoxine 5'-phosphate |
− | * | + | * smiles: |
− | ** | + | ** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co) |
− | == | + | * inchi-key: |
− | + | ** whomfkwhiqzthy-uhfffaoysa-l | |
− | + | * molecular-weight: | |
− | * | + | ** 247.144 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[PNPOXI-RXN]] |
− | + | * [[RXN-14181]] | |
− | ** | + | == Reaction(s) known to produce the compound == |
− | + | * [[PNKIN-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=pyridoxine 5'-phosphate}} | |
− | == | + | {{#set: inchi-key=inchikey=whomfkwhiqzthy-uhfffaoysa-l}} |
− | * [[ | + | {{#set: molecular-weight=247.144}} |
− | |||
− | == | ||
− | * | ||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite PYRIDOXINE-5P
- common-name:
- pyridoxine 5'-phosphate
- smiles:
- cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co)
- inchi-key:
- whomfkwhiqzthy-uhfffaoysa-l
- molecular-weight:
- 247.144