Difference between revisions of "PYRIDOXINE-5P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.3.67-RXN 3.1.3.67-RXN] == * direction: ** left-to-right * common-name: ** phosphatidylinositol-...")
(Created page with "Category:metabolite == Metabolite PYRIDOXINE-5P == * common-name: ** pyridoxine 5'-phosphate * smiles: ** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co) * inchi-key: ** whomfkwh...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.3.67-RXN 3.1.3.67-RXN] ==
+
== Metabolite PYRIDOXINE-5P ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase
+
** pyridoxine 5'-phosphate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/3.1.3.67 ec-3.1.3.67]
+
** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co)
== Reaction formula ==
+
* inchi-key:
* 1 [[PHOSPHATIDYLINOSITOL-345-TRIPHOSPHATE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PHOSPHATIDYL-MYO-INOSITOL-45-BISPHOSPHA]][c] '''+''' 1 [[Pi]][c]
+
** whomfkwhiqzthy-uhfffaoysa-l
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ11880]]
+
** 247.144
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[PNPOXI-RXN]]
** Category: [[orthology]]
+
* [[RXN-14181]]
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ03263]]
+
* [[PNKIN-RXN]]
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=pyridoxine 5'-phosphate}}
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=whomfkwhiqzthy-uhfffaoysa-l}}
* [[PWY-6368]], 3-phosphoinositide degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6368 PWY-6368]
+
{{#set: molecular-weight=247.144}}
** '''6''' reactions found over '''9''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25018 25018]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R04513 R04513]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=phosphatidylinositol-3,4,5-trisphosphate 3-phosphatase}}
 
{{#set: ec-number=ec-3.1.3.67}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_arabidopsis_thaliana}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite PYRIDOXINE-5P

  • common-name:
    • pyridoxine 5'-phosphate
  • smiles:
    • cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co)
  • inchi-key:
    • whomfkwhiqzthy-uhfffaoysa-l
  • molecular-weight:
    • 247.144

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality