|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18301 RXN-18301] == | + | == Metabolite CPD0-1812 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** galactosylceramide sulfotransferase | + | ** 2-oleoylglycerol |
| − | ** β-galactosyl-n-acylsphingosine sulfotransferase
| + | * smiles: |
| − | * ec-number: | + | ** ccccccccc=ccccccccc(=o)oc(co)co |
| − | ** [http://enzyme.expasy.org/EC/2.8.2.11 ec-2.8.2.11] | + | * inchi-key: |
| − | == Reaction formula == | + | ** upwgqkdvauruge-ktkrtigzsa-n |
| − | * 1 [[A-GALACTOSYLCERAMIDE]][c] '''+''' 1 [[PAPS]][c] '''=>''' 1 [[3-5-ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[galactosylceramide-sulfate]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction ==
| + | ** 356.545 |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to consume the compound == |
| − | * Gene: [[SJ05785]] | + | * [[RXN-15088]] |
| − | ** Category: [[annotation]]
| + | * [[RXN-15090]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | * [[RXN-15091]] |
| − | * Gene: [[SJ18184]] | + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | {{#set: common-name=2-oleoylglycerol}} |
| − | * Gene: [[SJ13393]]
| + | {{#set: inchi-key=inchikey=upwgqkdvauruge-ktkrtigzsa-n}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=356.545}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ11525]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ14141]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ13400]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ11352]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ13394]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ05173]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ20074]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ21441]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ09270]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY-7840]], gala-series glycosphingolipids biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7840 PWY-7840]
| |
| − | ** '''3''' reactions found over '''5''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | {{#set: direction=left-to-right}} | |
| − | {{#set: common-name=β-galactosyl-n-acylsphingosine sulfotransferase|galactosylceramide sulfotransferase}} | |
| − | {{#set: ec-number=ec-2.8.2.11}} | |
| − | {{#set: nb gene associated=12}}
| |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome}}
| |
