|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDROQUINATE-SYNTHASE-RXN 3-DEHYDROQUINATE-SYNTHASE-RXN] == | + | == Metabolite CPD-16819 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** 3-dehydroquinate synthase | + | ** 4-methylphenyl sulfate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/4.2.3.4 ec-4.2.3.4] | + | ** cc1(c=cc(=cc=1)os(=o)(=o)[o-]) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P]][c] '''=>''' 1 [[DEHYDROQUINATE]][c] '''+''' 1 [[Pi]][c]
| + | ** wgnakzgusrvwrh-uhfffaoysa-m |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ10493]]
| + | ** 187.19 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[RXN-15588]] |
| − | * Gene: [[SJ03966]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]]
| + | * [[RXN-15588]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[orthology]] | + | {{#set: common-name=4-methylphenyl sulfate}} |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: inchi-key=inchikey=wgnakzgusrvwrh-uhfffaoysa-m}} |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: molecular-weight=187.19}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ10220]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ15385]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | * [[PWY-6164]], 3-dehydroquinate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6164 PWY-6164] | |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21969 21969]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R03083 R03083]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P07547 P07547]
| |
| − | ** [http://www.uniprot.org/uniprot/P08566 P08566]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CES8 Q9CES8]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PNT2 Q9PNT2]
| |
| − | ** [http://www.uniprot.org/uniprot/P43879 P43879]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JVW5 Q9JVW5]
| |
| − | ** [http://www.uniprot.org/uniprot/P0A4Z4 P0A4Z4]
| |
| − | ** [http://www.uniprot.org/uniprot/P07639 P07639]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9P7R0 Q9P7R0]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=3-dehydroquinate synthase}} | |
| − | {{#set: ec-number=ec-4.2.3.4}} | |
| − | {{#set: nb gene associated=4}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana|saccharina_japonica_genome|output_pantograph_nannochloropsis_salina}}
| |
