Difference between revisions of "CARNITINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATPPHOSPHORIBOSYLTRANS-RXN ATPPHOSPHORIBOSYLTRANS-RXN] == * direction: ** reversible * common-name:...")
(Created page with "Category:metabolite == Metabolite CARNITINE == * common-name: ** l-carnitine * smiles: ** c(c(o)cc(=o)[o-])[n+](c)(c)c * inchi-key: ** phiqhxfuzvpyii-zcfiwibfsa-n * molecu...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATPPHOSPHORIBOSYLTRANS-RXN ATPPHOSPHORIBOSYLTRANS-RXN] ==
+
== Metabolite CARNITINE ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** atp phosphoribosyltransferase
+
** l-carnitine
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.4.2.17 ec-2.4.2.17]
+
** c(c(o)cc(=o)[o-])[n+](c)(c)c
== Reaction formula ==
+
* inchi-key:
* 1 [[PHOSPHORIBOSYL-ATP]][c] '''+''' 1 [[PPI]][c] '''<=>''' 1 [[ATP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PRPP]][c]
+
** phiqhxfuzvpyii-zcfiwibfsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ19466]]
+
** 161.2
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
** Category: [[orthology]]
+
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-9918]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
* [[HISTSYN-PWY]], L-histidine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=HISTSYN-PWY HISTSYN-PWY]
+
* [[1.14.11.1-RXN]]
** '''10''' reactions found over '''10''' reactions in the full pathway
+
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
== Reconstruction information  ==
+
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-9918]]
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
== External links  ==
+
{{#set: common-name=l-carnitine}}
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
{{#set: inchi-key=inchikey=phiqhxfuzvpyii-zcfiwibfsa-n}}
* RHEA:
+
{{#set: molecular-weight=161.2}}
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18476 18476]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R01071 R01071]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/Q9X0D2 Q9X0D2]
 
** [http://www.uniprot.org/uniprot/Q58601 Q58601]
 
** [http://www.uniprot.org/uniprot/O34520 O34520]
 
** [http://www.uniprot.org/uniprot/Q9RUE2 Q9RUE2]
 
** [http://www.uniprot.org/uniprot/P64347 P64347]
 
** [http://www.uniprot.org/uniprot/Q9PM78 Q9PM78]
 
** [http://www.uniprot.org/uniprot/Q02129 Q02129]
 
** [http://www.uniprot.org/uniprot/P43853 P43853]
 
** [http://www.uniprot.org/uniprot/O67543 O67543]
 
** [http://www.uniprot.org/uniprot/P40373 P40373]
 
** [http://www.uniprot.org/uniprot/P46586 P46586]
 
** [http://www.uniprot.org/uniprot/Q55503 Q55503]
 
** [http://www.uniprot.org/uniprot/Q9S762 Q9S762]
 
** [http://www.uniprot.org/uniprot/P00498 P00498]
 
** [http://www.uniprot.org/uniprot/P00499 P00499]
 
** [http://www.uniprot.org/uniprot/P60757 P60757]
 
</div>
 
{{#set: direction=reversible}}
 
{{#set: common-name=atp phosphoribosyltransferase}}
 
{{#set: ec-number=ec-2.4.2.17}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CARNITINE

  • common-name:
    • l-carnitine
  • smiles:
    • c(c(o)cc(=o)[o-])[n+](c)(c)c
  • inchi-key:
    • phiqhxfuzvpyii-zcfiwibfsa-n
  • molecular-weight:
    • 161.2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality