Difference between revisions of "DETHIOBIOTIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ACYL-ACP == * common-name: ** an acyl-[acyl-carrier protein] == Reaction(s) known to consume the compound == * 1-ACYLGLYCEROL-3-P-ACYLT...") |
(Created page with "Category:metabolite == Metabolite DETHIOBIOTIN == * common-name: ** dethiobiotin * smiles: ** cc1(nc(=o)nc1cccccc(=o)[o-]) * inchi-key: ** autolbmxddtrrt-uhfffaoysa-m * mo...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DETHIOBIOTIN == |
* common-name: | * common-name: | ||
− | ** | + | ** dethiobiotin |
+ | * smiles: | ||
+ | ** cc1(nc(=o)nc1cccccc(=o)[o-]) | ||
+ | * inchi-key: | ||
+ | ** autolbmxddtrrt-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 213.256 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[2.8.1.6-RXN]] | |
− | + | * [[RXN-17472]] | |
− | * [[2. | ||
− | * [[RXN- | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[DETHIOBIOTIN-SYN-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dethiobiotin}} |
+ | {{#set: inchi-key=inchikey=autolbmxddtrrt-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=213.256}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite DETHIOBIOTIN
- common-name:
- dethiobiotin
- smiles:
- cc1(nc(=o)nc1cccccc(=o)[o-])
- inchi-key:
- autolbmxddtrrt-uhfffaoysa-m
- molecular-weight:
- 213.256