Difference between revisions of "CPD0-2350"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FERULIC-ACID == * common-name: ** ferulate * smiles: ** coc1(=cc(c=cc([o-])=o)=cc=c(o)1) * inchi-key: ** ksebmyqbyztdhs-hwkanzrosa-m * mo...") |
(Created page with "Category:metabolite == Metabolite CPD0-2350 == * common-name: ** a polycistronic trna precursor == Reaction(s) known to consume the compound == * 3.1.27.9-RXN == React...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-2350 == |
* common-name: | * common-name: | ||
− | ** | + | ** a polycistronic trna precursor |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3.1.27.9-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a polycistronic trna precursor}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD0-2350
- common-name:
- a polycistronic trna precursor