Difference between revisions of "A-radical-of-luteolin-7-iOi-diglucuronid"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8089 == * common-name: ** 1-α-linolenoyl-2-oleoyl-phosphatidylcholine * smiles: ** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc...")
(Created page with "Category:metabolite == Metabolite a-radical-of-luteolin-7-iOi-diglucuronid == * common-name: ** a radical of luteolin-7-o-diglucuronide == Reaction(s) known to consume the...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8089 ==
+
== Metabolite a-radical-of-luteolin-7-iOi-diglucuronid ==
 
* common-name:
 
* common-name:
** 1-α-linolenoyl-2-oleoyl-phosphatidylcholine
+
** a radical of luteolin-7-o-diglucuronide
* smiles:
 
** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 
* inchi-key:
 
** lpdgucimnbnwej-bxzvqshesa-n
 
* molecular-weight:
 
** 782.092
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8330]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8321]]
+
* [[RXN-15288]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-α-linolenoyl-2-oleoyl-phosphatidylcholine}}
+
{{#set: common-name=a radical of luteolin-7-o-diglucuronide}}
{{#set: inchi-key=inchikey=lpdgucimnbnwej-bxzvqshesa-n}}
 
{{#set: molecular-weight=782.092}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite a-radical-of-luteolin-7-iOi-diglucuronid

  • common-name:
    • a radical of luteolin-7-o-diglucuronide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality