Difference between revisions of "OLEOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9854 == * common-name: ** 3-(all-trans-heptaprenyl)benzene-1,2-diol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=...")
(Created page with "Category:metabolite == Metabolite OLEOYL-COA == * common-name: ** oleoyl-coa * smiles: ** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9854 ==
+
== Metabolite OLEOYL-COA ==
 
* common-name:
 
* common-name:
** 3-(all-trans-heptaprenyl)benzene-1,2-diol
+
** oleoyl-coa
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c
+
** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** ooykexozubwosx-nfdzfspwsa-n
+
** xduhqpoxluavee-bpmmelmssa-j
 
* molecular-weight:
 
* molecular-weight:
** 586.94
+
** 1027.953
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9225]]
+
* [[RXN-13322]]
 +
* [[RXN-15036]]
 +
* [[RXN-15043]]
 +
* [[RXN-15044]]
 +
* [[RXN-15045]]
 +
* [[RXN-15090]]
 +
* [[RXN-17775]]
 +
* [[RXN-9601]]
 +
* [[RXN-9666]]
 +
* [[RXN-9670]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.14.19.1-RXN]]
 +
* [[RXN-15036]]
 +
* [[RXN-9644]]
 +
* [[RXN-9670]]
 +
* [[RXN0-7239]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(all-trans-heptaprenyl)benzene-1,2-diol}}
+
{{#set: common-name=oleoyl-coa}}
{{#set: inchi-key=inchikey=ooykexozubwosx-nfdzfspwsa-n}}
+
{{#set: inchi-key=inchikey=xduhqpoxluavee-bpmmelmssa-j}}
{{#set: molecular-weight=586.94}}
+
{{#set: molecular-weight=1027.953}}

Latest revision as of 11:11, 18 March 2021

Metabolite OLEOYL-COA

  • common-name:
    • oleoyl-coa
  • smiles:
    • ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • xduhqpoxluavee-bpmmelmssa-j
  • molecular-weight:
    • 1027.953

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality