Difference between revisions of "AMINO-HYDROXYMETHYL-METHYL-PYR-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SIROHYDROCHLORIN == * common-name: ** sirohydrochlorin * smiles: ** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c...")
(Created page with "Category:metabolite == Metabolite AMINO-HYDROXYMETHYL-METHYL-PYR-P == * common-name: ** 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine * smiles: ** cc1(n=cc(cop(=o)([o-])...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SIROHYDROCHLORIN ==
+
== Metabolite AMINO-HYDROXYMETHYL-METHYL-PYR-P ==
 
* common-name:
 
* common-name:
** sirohydrochlorin
+
** 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine
 
* smiles:
 
* smiles:
** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
+
** cc1(n=cc(cop(=o)([o-])[o-])=c(n=1)n)
 
* inchi-key:
 
* inchi-key:
** kwizrxmmfrbuml-ahgfgahvsa-f
+
** pkyfhkiyhbrtpi-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 854.779
+
** 217.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4.99.1.3-RXN]]
+
* [[PYRIMSYN3-RXN]]
* [[SIROHEME-FERROCHELAT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIMETHUROPORDEHYDROG-RXN]]
+
* [[OHMETPYRKIN-RXN]]
 +
* [[PYRIMSYN1-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sirohydrochlorin}}
+
{{#set: common-name=4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine}}
{{#set: inchi-key=inchikey=kwizrxmmfrbuml-ahgfgahvsa-f}}
+
{{#set: inchi-key=inchikey=pkyfhkiyhbrtpi-uhfffaoysa-l}}
{{#set: molecular-weight=854.779}}
+
{{#set: molecular-weight=217.121}}

Latest revision as of 11:11, 18 March 2021

Metabolite AMINO-HYDROXYMETHYL-METHYL-PYR-P

  • common-name:
    • 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine
  • smiles:
    • cc1(n=cc(cop(=o)([o-])[o-])=c(n=1)n)
  • inchi-key:
    • pkyfhkiyhbrtpi-uhfffaoysa-l
  • molecular-weight:
    • 217.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality