Difference between revisions of "A-pyruvate-dehydrogenase-E2-protein-Nsup"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16953 == * common-name: ** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin * smiles: ** cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2)) *...")
(Created page with "Category:metabolite == Metabolite a-pyruvate-dehydrogenase-E2-protein-Nsup == * common-name: ** a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine == Reaction(s) k...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-16953 ==
+
== Metabolite a-pyruvate-dehydrogenase-E2-protein-Nsup ==
 
* common-name:
 
* common-name:
** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
+
** a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine
* smiles:
 
** cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2))
 
* inchi-key:
 
** ghrbcdhnysufrn-iuyqgcfvsa-n
 
* molecular-weight:
 
** 223.234
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15733]]
+
* [[RXN-14957]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin}}
+
{{#set: common-name=a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine}}
{{#set: inchi-key=inchikey=ghrbcdhnysufrn-iuyqgcfvsa-n}}
 
{{#set: molecular-weight=223.234}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite a-pyruvate-dehydrogenase-E2-protein-Nsup

  • common-name:
    • a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.