Difference between revisions of "HEXANOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CREATININE == * common-name: ** creatinine * smiles: ** cn1(cc(=o)nc(=n)1) * inchi-key: ** ddrjaanprjihgj-uhfffaoysa-n * molecular-weight...")
(Created page with "Category:metabolite == Metabolite HEXANOYL-COA == * common-name: ** hexanoyl-coa * smiles: ** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CREATININE ==
+
== Metabolite HEXANOYL-COA ==
 
* common-name:
 
* common-name:
** creatinine
+
** hexanoyl-coa
 
* smiles:
 
* smiles:
** cn1(cc(=o)nc(=n)1)
+
** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** ddrjaanprjihgj-uhfffaoysa-n
+
** oexfmsfodmqepe-hdrqghtbsa-j
 
* molecular-weight:
 
* molecular-weight:
** 113.119
+
** 861.647
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CREATININASE-RXN]]
+
* [[3.1.2.19-RXN-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.42.]]
 +
* [[ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.]]
 +
* [[RXN-14277]]
 +
* [[RXN-14278]]
 +
* [[THIOESTER-RXN[CCO-CYTOSOL]-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.55.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CREATININASE-RXN]]
+
* [[RXN-12559]]
 +
* [[RXN-14277]]
 +
* [[RXN-14278]]
 +
* [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=creatinine}}
+
{{#set: common-name=hexanoyl-coa}}
{{#set: inchi-key=inchikey=ddrjaanprjihgj-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=oexfmsfodmqepe-hdrqghtbsa-j}}
{{#set: molecular-weight=113.119}}
+
{{#set: molecular-weight=861.647}}

Latest revision as of 11:11, 18 March 2021

Metabolite HEXANOYL-COA

  • common-name:
    • hexanoyl-coa
  • smiles:
    • cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • oexfmsfodmqepe-hdrqghtbsa-j
  • molecular-weight:
    • 861.647

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality