Difference between revisions of "CPD-7066"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4201 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)...") |
(Created page with "Category:metabolite == Metabolite CPD-7066 == * common-name: ** (2r,3s)-3-methylmalate * smiles: ** cc(c(=o)[o-])c(o)c([o-])=o * inchi-key: ** npyqjihhtgfbln-sthayslisa-l...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-7066 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2r,3s)-3-methylmalate |
* smiles: | * smiles: | ||
| − | ** cc | + | ** cc(c(=o)[o-])c(o)c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** npyqjihhtgfbln-sthayslisa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 146.099 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-7745]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2r,3s)-3-methylmalate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=npyqjihhtgfbln-sthayslisa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=146.099}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-7066
- common-name:
- (2r,3s)-3-methylmalate
- smiles:
- cc(c(=o)[o-])c(o)c([o-])=o
- inchi-key:
- npyqjihhtgfbln-sthayslisa-l
- molecular-weight:
- 146.099
