Difference between revisions of "CPD-4201"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Trans-D2-decenoyl-ACPs == * common-name: ** a (2e)-dec-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9530 * R...")
(Created page with "Category:metabolite == Metabolite CPD-4201 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Trans-D2-decenoyl-ACPs ==
+
== Metabolite CPD-4201 ==
 
* common-name:
 
* common-name:
** a (2e)-dec-2-enoyl-[acp]
+
** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate
 +
* smiles:
 +
** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)([o-])=o)o)o))c=nc=23)))c
 +
* inchi-key:
 +
** oplvztyvquwkhb-sdbhatresa-k
 +
* molecular-weight:
 +
** 572.278
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9530]]
 
* [[RXN-9660]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9655]]
+
* [[RXN-4303]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (2e)-dec-2-enoyl-[acp]}}
+
{{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-triphosphate}}
 +
{{#set: inchi-key=inchikey=oplvztyvquwkhb-sdbhatresa-k}}
 +
{{#set: molecular-weight=572.278}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-4201

  • common-name:
    • n6-(δ2-isopentenyl)-adenosine 5'-triphosphate
  • smiles:
    • cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)([o-])=o)o)o))c=nc=23)))c
  • inchi-key:
    • oplvztyvquwkhb-sdbhatresa-k
  • molecular-weight:
    • 572.278

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality