Difference between revisions of "CPD-19487"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-9-O-ACETYLNEURAMINATE == * common-name: ** n-acetyl-9-o-acetylneuraminate * smiles: ** cc(nc1(c(cc(o)(c(=o)[o-])oc1c(c(coc(=o)c)...") |
(Created page with "Category:metabolite == Metabolite CPD-19487 == * common-name: ** 3-isopropyl-10-(methylthio)-2-oxodecanoate * smiles: ** cscccccccc(c(=o)c(=o)[o-])c(=o)[o-] * inchi-key: *...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19487 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-isopropyl-10-(methylthio)-2-oxodecanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** cscccccccc(c(=o)c(=o)[o-])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ukhzbtwecwuvph-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 274.331 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-18200]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-18200]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-isopropyl-10-(methylthio)-2-oxodecanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ukhzbtwecwuvph-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=274.331}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-19487
- common-name:
- 3-isopropyl-10-(methylthio)-2-oxodecanoate
- smiles:
- cscccccccc(c(=o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- ukhzbtwecwuvph-uhfffaoysa-l
- molecular-weight:
- 274.331
