Difference between revisions of "5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MG-PROTOPORPHYRIN-MONOMETHYL-ESTER == * smiles: ** c=cc2(c(c)=c4(c=c8(c(c)=c(ccc(=o)[o-])c7(=n([mg]35(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c6(c(...")
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY == * common-name: ** prostaglandin f2α * smiles: ** cccccc(o)c=cc1(c(o)cc(o)c(cc=ccccc(=o)[o-])1)...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MG-PROTOPORPHYRIN-MONOMETHYL-ESTER ==
+
== Metabolite 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY ==
 +
* common-name:
 +
** prostaglandin f2α
 
* smiles:
 
* smiles:
** c=cc2(c(c)=c4(c=c8(c(c)=c(ccc(=o)[o-])c7(=n([mg]35(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c6(c(c)=c(ccc(=o)oc)c(n56)=c7))))8))))
+
** cccccc(o)c=cc1(c(o)cc(o)c(cc=ccccc(=o)[o-])1)
* common-name:
+
* inchi-key:
** magnesium-protoporphyrin ix 13-monomethyl ester
+
** pxgpltodnuvgfl-ynnpmvkqsa-m
 
* molecular-weight:
 
* molecular-weight:
** 597.975
+
** 353.478
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.1.1.188-RXN]]
 +
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
+
* [[1.1.1.188-RXN]]
 +
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=magnesium-protoporphyrin ix 13-monomethyl ester}}
+
{{#set: common-name=prostaglandin f2α}}
{{#set: molecular-weight=597.975}}
+
{{#set: inchi-key=inchikey=pxgpltodnuvgfl-ynnpmvkqsa-m}}
 +
{{#set: molecular-weight=353.478}}

Latest revision as of 11:12, 18 March 2021

Metabolite 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY

  • common-name:
    • prostaglandin f2α
  • smiles:
    • cccccc(o)c=cc1(c(o)cc(o)c(cc=ccccc(=o)[o-])1)
  • inchi-key:
    • pxgpltodnuvgfl-ynnpmvkqsa-m
  • molecular-weight:
    • 353.478

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality