Difference between revisions of "Guanosine-34-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LIPOYL-AMP == * common-name: ** lipoyl-adenylate * smiles: ** c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=...")
(Created page with "Category:metabolite == Metabolite guanosine-34-tRNAs == * common-name: ** a guanosine34 in trna == Reaction(s) known to consume the compound == * RXN-11868 == Reaction...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LIPOYL-AMP ==
+
== Metabolite guanosine-34-tRNAs ==
 
* common-name:
 
* common-name:
** lipoyl-adenylate
+
** a guanosine34 in trna
* smiles:
 
** c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=o)
 
* inchi-key:
 
** qwegocjrzoksoe-aduakinbsa-m
 
* molecular-weight:
 
** 534.518
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13039]]
+
* [[RXN-11868]]
* [[RXN-8655]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8654]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=lipoyl-adenylate}}
+
{{#set: common-name=a guanosine34 in trna}}
{{#set: inchi-key=inchikey=qwegocjrzoksoe-aduakinbsa-m}}
 
{{#set: molecular-weight=534.518}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite guanosine-34-tRNAs

  • common-name:
    • a guanosine34 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality