Difference between revisions of "CPD-16458"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-1-PHOSPHATIDYL-GLYCEROL-P == * common-name: ** 1-(3-sn-phosphatidyl)-sn-glycerol 3-phosphate == Reaction(s) known to consume the compou...")
(Created page with "Category:metabolite == Metabolite CPD-16458 == * common-name: ** 7,8-dihydrolumazine * smiles: ** c2(=o)(c1(=c(ncc=n1)nc(=o)n2)) * inchi-key: ** myjneehzesremo-uhfffaoysa-...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-1-PHOSPHATIDYL-GLYCEROL-P ==
+
== Metabolite CPD-16458 ==
 
* common-name:
 
* common-name:
** 1-(3-sn-phosphatidyl)-sn-glycerol 3-phosphate
+
** 7,8-dihydrolumazine
 +
* smiles:
 +
** c2(=o)(c1(=c(ncc=n1)nc(=o)n2))
 +
* inchi-key:
 +
** myjneehzesremo-uhfffaoysa-n
 +
* molecular-weight:
 +
** 166.139
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PGPPHOSPHA-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PHOSPHAGLYPSYN-RXN]]
+
* [[RXN-15261]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-(3-sn-phosphatidyl)-sn-glycerol 3-phosphate}}
+
{{#set: common-name=7,8-dihydrolumazine}}
 +
{{#set: inchi-key=inchikey=myjneehzesremo-uhfffaoysa-n}}
 +
{{#set: molecular-weight=166.139}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-16458

  • common-name:
    • 7,8-dihydrolumazine
  • smiles:
    • c2(=o)(c1(=c(ncc=n1)nc(=o)n2))
  • inchi-key:
    • myjneehzesremo-uhfffaoysa-n
  • molecular-weight:
    • 166.139

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality