Difference between revisions of "CPD-692"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Long-Chain-oxoacyl-CoAs == * common-name: ** a long-chain 3-oxoacyl-coa == Reaction(s) known to consume the compound == * 1.1.1.211-RXN...") |
(Created page with "Category:metabolite == Metabolite CPD-692 == * common-name: ** (+)-cis-abscisic aldehyde * smiles: ** cc(=cc=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o * inchi-key: ** rikwdzwvhuiuam-...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-692 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (+)-cis-abscisic aldehyde |
| + | * smiles: | ||
| + | ** cc(=cc=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o | ||
| + | * inchi-key: | ||
| + | ** rikwdzwvhuiuam-kicrzjjpsa-n | ||
| + | * molecular-weight: | ||
| + | ** 248.321 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[1. | + | * [[1.2.3.14-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[1.1.1. | + | * [[1.1.1.288-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(+)-cis-abscisic aldehyde}} |
| + | {{#set: inchi-key=inchikey=rikwdzwvhuiuam-kicrzjjpsa-n}} | ||
| + | {{#set: molecular-weight=248.321}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-692
- common-name:
- (+)-cis-abscisic aldehyde
- smiles:
- cc(=cc=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o
- inchi-key:
- rikwdzwvhuiuam-kicrzjjpsa-n
- molecular-weight:
- 248.321
