Difference between revisions of "4-hydroxybenzoate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-XYLULOSE == * common-name: ** l-xylulose * smiles: ** c(o)c(o)c(o)c(=o)co * inchi-key: ** zaqjhhrnxzubte-wvzvxsggsa-n * molecular-weigh...")
(Created page with "Category:metabolite == Metabolite 4-hydroxybenzoate == * common-name: ** 4-hydroxybenzoate * smiles: ** c(c1(c=cc(=cc=1)o))(=o)[o-] * inchi-key: ** fjkrolugyxjwqn-uhfffaoy...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-XYLULOSE ==
+
== Metabolite 4-hydroxybenzoate ==
 
* common-name:
 
* common-name:
** l-xylulose
+
** 4-hydroxybenzoate
 
* smiles:
 
* smiles:
** c(o)c(o)c(o)c(=o)co
+
** c(c1(c=cc(=cc=1)o))(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** zaqjhhrnxzubte-wvzvxsggsa-n
+
** fjkrolugyxjwqn-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 150.131
+
** 137.115
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[L-XYLULOSE-REDUCTASE-RXN]]
+
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
 +
* [[RXN-9003]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[L-XYLULOSE-REDUCTASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-xylulose}}
+
{{#set: common-name=4-hydroxybenzoate}}
{{#set: inchi-key=inchikey=zaqjhhrnxzubte-wvzvxsggsa-n}}
+
{{#set: inchi-key=inchikey=fjkrolugyxjwqn-uhfffaoysa-m}}
{{#set: molecular-weight=150.131}}
+
{{#set: molecular-weight=137.115}}

Latest revision as of 11:12, 18 March 2021

Metabolite 4-hydroxybenzoate

  • common-name:
    • 4-hydroxybenzoate
  • smiles:
    • c(c1(c=cc(=cc=1)o))(=o)[o-]
  • inchi-key:
    • fjkrolugyxjwqn-uhfffaoysa-m
  • molecular-weight:
    • 137.115

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality