Difference between revisions of "CPD-15913"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PRO == * common-name: ** l-proline * smiles: ** c1([n+]c(cc1)c(=o)[o-]) * inchi-key: ** onibwkktopovia-bypyzucnsa-n * molecular-weight: *...") |
(Created page with "Category:metabolite == Metabolite CPD-15913 == * common-name: ** aurachin c epoxide * smiles: ** cc(c)=cccc(c)=cccc(c)=ccc12(oc(c)1n(c3(c=cc=cc(c2=o)=3))o) * inchi-key: **...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15913 == |
* common-name: | * common-name: | ||
| − | ** | + | ** aurachin c epoxide |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cccc(c)=cccc(c)=ccc12(oc(c)1n(c3(c=cc=cc(c2=o)=3))o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** forhhprbeftlrm-yefhwucqsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 395.541 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-15029]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=aurachin c epoxide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=forhhprbeftlrm-yefhwucqsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=395.541}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-15913
- common-name:
- aurachin c epoxide
- smiles:
- cc(c)=cccc(c)=cccc(c)=ccc12(oc(c)1n(c3(c=cc=cc(c2=o)=3))o)
- inchi-key:
- forhhprbeftlrm-yefhwucqsa-n
- molecular-weight:
- 395.541
