Difference between revisions of "CPD-8090"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Guanine37-in-tRNA == * common-name: ** a guanine37 in trna == Reaction(s) known to consume the compound == * RXN-12458 == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite CPD-8090 == * common-name: ** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine * smiles: ** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Guanine37-in-tRNA ==
+
== Metabolite CPD-8090 ==
 
* common-name:
 
* common-name:
** a guanine37 in trna
+
** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine
 +
* smiles:
 +
** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 +
* inchi-key:
 +
** qfdyidgukxrpkh-vslglsmxsa-n
 +
* molecular-weight:
 +
** 780.076
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12458]]
+
* [[RXN-8331]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8323]]
 +
* [[RXN-8330]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a guanine37 in trna}}
+
{{#set: common-name=1-α-linolenoyl-2-linoleoyl-phosphatidylcholine}}
 +
{{#set: inchi-key=inchikey=qfdyidgukxrpkh-vslglsmxsa-n}}
 +
{{#set: molecular-weight=780.076}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-8090

  • common-name:
    • 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine
  • smiles:
    • ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
  • inchi-key:
    • qfdyidgukxrpkh-vslglsmxsa-n
  • molecular-weight:
    • 780.076

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality