Difference between revisions of "CPD-9446"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYXYLULOSE-5P == * common-name: ** 1-deoxy-d-xylulose 5-phosphate * smiles: ** cc(=o)c(o)c(o)cop([o-])(=o)[o-] * inchi-key: ** ajpadpz...") |
(Created page with "Category:metabolite == Metabolite CPD-9446 == * common-name: ** 1,5-anhydro-d-mannitol * smiles: ** c(o)c1(occ(o)c(o)c(o)1) * inchi-key: ** mpcajmnynogxpb-kvtdhhqdsa-n * m...") |
||
(6 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-9446 == |
* common-name: | * common-name: | ||
− | ** 1- | + | ** 1,5-anhydro-d-mannitol |
* smiles: | * smiles: | ||
− | ** | + | ** c(o)c1(occ(o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** mpcajmnynogxpb-kvtdhhqdsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 164.158 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13064]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=1- | + | {{#set: common-name=1,5-anhydro-d-mannitol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mpcajmnynogxpb-kvtdhhqdsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=164.158}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-9446
- common-name:
- 1,5-anhydro-d-mannitol
- smiles:
- c(o)c1(occ(o)c(o)c(o)1)
- inchi-key:
- mpcajmnynogxpb-kvtdhhqdsa-n
- molecular-weight:
- 164.158