Difference between revisions of "Unwound-RNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DGMP == * common-name: ** dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** ltfmzdnnppeqng-k...") |
(Created page with "Category:metabolite == Metabolite Unwound-RNA == * common-name: ** an unwound rna == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compo...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Unwound-RNA == |
* common-name: | * common-name: | ||
| − | ** | + | ** an unwound rna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-11109]] | |
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an unwound rna}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Unwound-RNA
- common-name:
- an unwound rna
