Difference between revisions of "L-methionyl-L-valyl-Protein"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-499 == * common-name: ** (r)-mevalonate 5-phosphate * smiles: ** cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-] * inchi-key: ** okzycxhttzzysk-z...") |
(Created page with "Category:metabolite == Metabolite L-methionyl-L-valyl-Protein == * common-name: ** an n-terminal-l-methionyl-l-valyl-[protein] == Reaction(s) known to consume the compound...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-methionyl-L-valyl-Protein == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-terminal-l-methionyl-l-valyl-[protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17878]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-terminal-l-methionyl-l-valyl-[protein]}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite L-methionyl-L-valyl-Protein
- common-name:
- an n-terminal-l-methionyl-l-valyl-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-terminal-l-methionyl-l-valyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
