Difference between revisions of "CPD66-39"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-194 == * common-name: ** 4-nitrophenyl phosphate * smiles: ** c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1) * inchi-key: ** xzkihkmte...") |
(Created page with "Category:metabolite == Metabolite CPD66-39 == * common-name: ** a 2,3,4-saturated fatty acid == Reaction(s) known to consume the compound == * ACYLCOASYN-RXN * TRANS...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD66-39 == |
* common-name: | * common-name: | ||
| − | ** 4- | + | ** a 2,3,4-saturated fatty acid |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ACYLCOASYN-RXN]] |
| + | * [[TRANS-RXN0-623]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[THIOESTER-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=4- | + | {{#set: common-name=a 2,3,4-saturated fatty acid}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD66-39
- common-name:
- a 2,3,4-saturated fatty acid
