Difference between revisions of "CPD-14706"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N6-Methyladenine-containing-mRNAs == * common-name: ** an n6-methyladenine in mrna == Reaction(s) known to consume the compound == * RX...") |
(Created page with "Category:metabolite == Metabolite CPD-14706 == * common-name: ** 4-hydroxy-2-nonenal-[l-cys] conjugate * smiles: ** cccccc(o)c(cc=o)scc([n+])c(=o)[o-] * inchi-key: ** salp...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-14706 == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-hydroxy-2-nonenal-[l-cys] conjugate |
+ | * smiles: | ||
+ | ** cccccc(o)c(cc=o)scc([n+])c(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** salpdushmtyyoh-uhfffaoysa-n | ||
+ | * molecular-weight: | ||
+ | ** 277.378 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-13677]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-hydroxy-2-nonenal-[l-cys] conjugate}} |
+ | {{#set: inchi-key=inchikey=salpdushmtyyoh-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=277.378}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-14706
- common-name:
- 4-hydroxy-2-nonenal-[l-cys] conjugate
- smiles:
- cccccc(o)c(cc=o)scc([n+])c(=o)[o-]
- inchi-key:
- salpdushmtyyoh-uhfffaoysa-n
- molecular-weight:
- 277.378
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "4-hydroxy-2-nonenal-[l-cys] conjugate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.