Difference between revisions of "ANDROST4ENE"

Latest revision as of 11:13, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite DIHYDRONEOPTERIN-P ==
+== Metabolite ANDROST4ENE ==
 * common-name:
-** 7,8-dihydroneopterin 3'-phosphate
+** androst-4-ene-3,17-dione
 * smiles:
-** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-])=2))
+** cc34(ccc(=o)c=c(cc[ch]1([ch](ccc2(c)(c(cc[ch]12)=o))3))4)
 * inchi-key:
-** plsqmgzyogsoce-xinawcovsa-l
+** aemfnilzojdqlw-qaggrknesa-n
 * molecular-weight:
-** 333.197
+** 286.413
 == Reaction(s) known to consume the compound ==
-* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
+* [[1.1.1.64-RXN]]
+* [[TESTOSTERONE-17-BETA-DEHYDROGENASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
+* [[1.1.1.51-RXN]]
+* [[RXN-12124]]
+* [[TESTOSTERONE-17-BETA-DEHYDROGENASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=7,8-dihydroneopterin 3'-phosphate}}
+{{#set: common-name=androst-4-ene-3,17-dione}}
-{{#set: inchi-key=inchikey=plsqmgzyogsoce-xinawcovsa-l}}
+{{#set: inchi-key=inchikey=aemfnilzojdqlw-qaggrknesa-n}}
-{{#set: molecular-weight=333.197}}
+{{#set: molecular-weight=286.413}}