Difference between revisions of "CPD-2752"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE == * common-name: ** adp-d-ribose * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)...")
(Created page with "Category:metabolite == Metabolite CPD-2752 == * common-name: ** trans-3-hydroxycotinine-glucuronide * smiles: ** c2(=o)(c(oc1(c(c(c(c(o1)c([o-])=o)o)o)o))c[ch](n(c)2)c3(=c...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE ==
+
== Metabolite CPD-2752 ==
 
* common-name:
 
* common-name:
** adp-d-ribose
+
** trans-3-hydroxycotinine-glucuronide
 
* smiles:
 
* smiles:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(o)c(o)c(o4)o))(=o)[o-]
+
** c2(=o)(c(oc1(c(c(c(c(o1)c([o-])=o)o)o)o))c[ch](n(c)2)c3(=cn=cc=c3))
 
* inchi-key:
 
* inchi-key:
** srnwougrcwsemx-tyasjmozsa-l
+
** walnnkzughysct-mbwyjtgfsa-m
 
* molecular-weight:
 
* molecular-weight:
** 557.303
+
** 367.335
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARDP]]
 
* [[RXN0-1441]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN66-162]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adp-d-ribose}}
+
{{#set: common-name=trans-3-hydroxycotinine-glucuronide}}
{{#set: inchi-key=inchikey=srnwougrcwsemx-tyasjmozsa-l}}
+
{{#set: inchi-key=inchikey=walnnkzughysct-mbwyjtgfsa-m}}
{{#set: molecular-weight=557.303}}
+
{{#set: molecular-weight=367.335}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-2752

  • common-name:
    • trans-3-hydroxycotinine-glucuronide
  • smiles:
    • c2(=o)(c(oc1(c(c(c(c(o1)c([o-])=o)o)o)o))c[ch](n(c)2)c3(=cn=cc=c3))
  • inchi-key:
    • walnnkzughysct-mbwyjtgfsa-m
  • molecular-weight:
    • 367.335

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality