Difference between revisions of "Core-Protein-L-Ser-Xyl"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15436 == * common-name: ** (5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...")
(Created page with "Category:metabolite == Metabolite Core-Protein-L-Ser-Xyl == * common-name: ** a [protein]-3-o-(β-d-xylosyl)-l-serine == Reaction(s) known to consume the compound == =...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15436 ==
+
== Metabolite Core-Protein-L-Ser-Xyl ==
 
* common-name:
 
* common-name:
** (5z)-tetradecenoyl-coa
+
** a [protein]-3-o-(β-d-xylosyl)-l-serine
* smiles:
 
** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** mrvdzohjmltlhj-stfckwfxsa-j
 
* molecular-weight:
 
** 971.845
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14576]]
 
* [[RXN-17783]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17782]]
+
* [[2.4.2.26-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(5z)-tetradecenoyl-coa}}
+
{{#set: common-name=a [protein]-3-o-(β-d-xylosyl)-l-serine}}
{{#set: inchi-key=inchikey=mrvdzohjmltlhj-stfckwfxsa-j}}
 
{{#set: molecular-weight=971.845}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Core-Protein-L-Ser-Xyl

  • common-name:
    • a [protein]-3-o-(β-d-xylosyl)-l-serine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-3-o-(β-d-xylosyl)-l-serine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.