Difference between revisions of "Phenyl-Acetates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PARATHION == * common-name: ** parathion * smiles: ** ccop(oc1(c=cc(=cc=1)[n+](=o)[o-]))(occ)=s * inchi-key: ** lccncvornkjirz-uhfffaoysa...") |
(Created page with "Category:metabolite == Metabolite Phenyl-Acetates == * common-name: ** a phenyl acetate == Reaction(s) known to consume the compound == * ARYLESTERASE-RXN == Reaction(...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Phenyl-Acetates == |
* common-name: | * common-name: | ||
− | ** | + | ** a phenyl acetate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ARYLESTERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a phenyl acetate}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Phenyl-Acetates
- common-name:
- a phenyl acetate