Difference between revisions of "AMMONIA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-36 == * common-name: ** 3-[(3'-methylthio)propyl]malate * smiles: ** c(c(cccsc)c(o)c(=o)[o-])(=o)[o-] * inchi-key: ** sqxviiopmysnc...") |
(Created page with "Category:metabolite == Metabolite AMMONIA == * common-name: ** ammonia * smiles: ** [nh3] * inchi-key: ** qgzkdvfqnngyky-uhfffaoysa-n * molecular-weight: ** 17.03 == React...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite AMMONIA == |
* common-name: | * common-name: | ||
− | ** | + | ** ammonia |
* smiles: | * smiles: | ||
− | ** | + | ** [nh3] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qgzkdvfqnngyky-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 17.03 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ExchangeSeed-AMMONIA]] |
− | * [[ | + | * [[TransportSeed-AMMONIA]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[ExchangeSeed-AMMONIA]] |
+ | * [[RXN-17130]] | ||
+ | * [[TransportSeed-AMMONIA]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ammonia}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qgzkdvfqnngyky-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=17.03}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite AMMONIA
- common-name:
- ammonia
- smiles:
- [nh3]
- inchi-key:
- qgzkdvfqnngyky-uhfffaoysa-n
- molecular-weight:
- 17.03