Difference between revisions of "CPD-11523"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-24189 == == Reaction(s) known to consume the compound == * RXN-22204 == Reaction(s) known to produce the compound == * RXN-2220...") |
(Created page with "Category:metabolite == Metabolite CPD-11523 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(o)...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-11523 == |
+ | * common-name: | ||
+ | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa | ||
+ | * smiles: | ||
+ | ** ccc=ccc1(c(ccc(=o)1)cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o) | ||
+ | * inchi-key: | ||
+ | ** omdqviuydjawhx-qhzcmhftsa-j | ||
+ | * molecular-weight: | ||
+ | ** 1027.866 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-10702]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-10704]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa}} | ||
+ | {{#set: inchi-key=inchikey=omdqviuydjawhx-qhzcmhftsa-j}} | ||
+ | {{#set: molecular-weight=1027.866}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-11523
- common-name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa
- smiles:
- ccc=ccc1(c(ccc(=o)1)cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
- inchi-key:
- omdqviuydjawhx-qhzcmhftsa-j
- molecular-weight:
- 1027.866