Difference between revisions of "MANNOSE-1P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-GLUCURONOLACTONE == * common-name: ** d-glucurono-6,3-lactone * smiles: ** c1(=o)(c(o)c(o)[ch](c(o)c=o)o1) * inchi-key: ** uyuxsradsppk...") |
(Created page with "Category:metabolite == Metabolite MANNOSE-1P == * common-name: ** α-d-mannose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** hxxf...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite MANNOSE-1P == |
* common-name: | * common-name: | ||
− | ** d- | + | ** α-d-mannose 1-phosphate |
* smiles: | * smiles: | ||
− | ** | + | ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hxxfsfrbohsimq-rwopyejcsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 258.121 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[MANNPGUANYLTRANGDP-RXN]] |
+ | * [[PHOSMANMUT-RXN]] | ||
+ | * [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]] | ||
+ | * [[RXN4FS-12]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[MANNPGUANYLTRANGDP-RXN]] | ||
+ | * [[PHOSMANMUT-RXN]] | ||
+ | * [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=d- | + | {{#set: common-name=α-d-mannose 1-phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hxxfsfrbohsimq-rwopyejcsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=258.121}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite MANNOSE-1P
- common-name:
- α-d-mannose 1-phosphate
- smiles:
- c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
- inchi-key:
- hxxfsfrbohsimq-rwopyejcsa-l
- molecular-weight:
- 258.121