Difference between revisions of "3-Hydroxy-Terminated-DNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-237 == * common-name: ** (indol-3-yl)acetamide * smiles: ** c(n)(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** zoambxdogprzlp-uhfffaoysa-...") |
(Created page with "Category:metabolite == Metabolite 3-Hydroxy-Terminated-DNAs == * common-name: ** a [dna]-3'-hydroxyl == Reaction(s) known to consume the compound == * DNA-LIGASE-ATP-RXN...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-Hydroxy-Terminated-DNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [dna]-3'-hydroxyl |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DNA-LIGASE-ATP-RXN]] |
| + | * [[DNA-LIGASE-NAD+-RXN]] | ||
| + | * [[RXN-15712]] | ||
| + | * [[RXN-15713]] | ||
| + | * [[RXN-17919]] | ||
| + | * [[RXN-17923]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [dna]-3'-hydroxyl}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 3-Hydroxy-Terminated-DNAs
- common-name:
- a [dna]-3'-hydroxyl
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [dna]-3'-hydroxyl" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
