Difference between revisions of "Nucleotides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-397 == * common-name: ** s-methyl-l-methionine * smiles: ** c[s+](ccc([n+])c(=o)[o-])c * inchi-key: ** ydbyjhtyshbbau-yfkpbyrvsa-o *...") |
(Created page with "Category:metabolite == Metabolite Nucleotides == * common-name: ** a nucleotide == Reaction(s) known to consume the compound == * NUCLEOTIDASE-RXN == Reaction(s) known...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Nucleotides == |
* common-name: | * common-name: | ||
| − | ** | + | ** a nucleotide |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[NUCLEOTIDASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a nucleotide}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite Nucleotides
- common-name:
- a nucleotide
