Difference between revisions of "Poly-D-galactosamine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10664 == * common-name: ** 5-methylsalicylate * smiles: ** cc1(=cc(=c(c=c1)o)c([o-])=o) * inchi-key: ** dlgbegbhxsaqoc-uhfffaoysa-m *...")
(Created page with "Category:metabolite == Metabolite Poly-D-galactosamine == * common-name: ** a poly-d-galactosamine == Reaction(s) known to consume the compound == * 3.2.1.109-RXN == R...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10664 ==
+
== Metabolite Poly-D-galactosamine ==
 
* common-name:
 
* common-name:
** 5-methylsalicylate
+
** a poly-d-galactosamine
* smiles:
 
** cc1(=cc(=c(c=c1)o)c([o-])=o)
 
* inchi-key:
 
** dlgbegbhxsaqoc-uhfffaoysa-m
 
* molecular-weight:
 
** 151.141
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10079]]
+
* [[3.2.1.109-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-methylsalicylate}}
+
{{#set: common-name=a poly-d-galactosamine}}
{{#set: inchi-key=inchikey=dlgbegbhxsaqoc-uhfffaoysa-m}}
 
{{#set: molecular-weight=151.141}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite Poly-D-galactosamine

  • common-name:
    • a poly-d-galactosamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality