Difference between revisions of "CPD-10664"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15709 == * common-name: ** keto-d-fructose 6-phosphate == Reaction(s) known to consume the compound == * RXN-14812 == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite CPD-10664 == * common-name: ** 5-methylsalicylate * smiles: ** cc1(=cc(=c(c=c1)o)c([o-])=o) * inchi-key: ** dlgbegbhxsaqoc-uhfffaoysa-m *...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15709 ==
+
== Metabolite CPD-10664 ==
 
* common-name:
 
* common-name:
** keto-d-fructose 6-phosphate
+
** 5-methylsalicylate
 +
* smiles:
 +
** cc1(=cc(=c(c=c1)o)c([o-])=o)
 +
* inchi-key:
 +
** dlgbegbhxsaqoc-uhfffaoysa-m
 +
* molecular-weight:
 +
** 151.141
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14812]]
+
* [[RXN-10079]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14812]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=keto-d-fructose 6-phosphate}}
+
{{#set: common-name=5-methylsalicylate}}
 +
{{#set: inchi-key=inchikey=dlgbegbhxsaqoc-uhfffaoysa-m}}
 +
{{#set: molecular-weight=151.141}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-10664

  • common-name:
    • 5-methylsalicylate
  • smiles:
    • cc1(=cc(=c(c=c1)o)c([o-])=o)
  • inchi-key:
    • dlgbegbhxsaqoc-uhfffaoysa-m
  • molecular-weight:
    • 151.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality