Difference between revisions of "TRNA-with-5-taurinomethyl-2-thiouridine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CYS-GLY == * common-name: ** l-cysteinyl-glycine * smiles: ** c(c([o-])=o)nc(c(cs)[n+])=o * inchi-key: ** zukpvrwzdmrieo-vkhmyheasa-n * m...")
(Created page with "Category:metabolite == Metabolite tRNA-with-5-taurinomethyl-2-thiouridine == * common-name: ** a 5-taurinomethyl-2-thiouridine in trna == Reaction(s) known to consume the...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CYS-GLY ==
+
== Metabolite tRNA-with-5-taurinomethyl-2-thiouridine ==
 
* common-name:
 
* common-name:
−
** l-cysteinyl-glycine
+
** a 5-taurinomethyl-2-thiouridine in trna
−
* smiles:
 
−
** c(c([o-])=o)nc(c(cs)[n+])=o
 
−
* inchi-key:
 
−
** zukpvrwzdmrieo-vkhmyheasa-n
 
−
* molecular-weight:
 
−
** 178.206
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-6622]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-12618]]
+
* [[RXN-16821]]
−
* [[RXN-18092]]
 
−
* [[RXN-6601]]
 
−
* [[RXN-9157]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=l-cysteinyl-glycine}}
+
{{#set: common-name=a 5-taurinomethyl-2-thiouridine in trna}}
−
{{#set: inchi-key=inchikey=zukpvrwzdmrieo-vkhmyheasa-n}}
 
−
{{#set: molecular-weight=178.206}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite tRNA-with-5-taurinomethyl-2-thiouridine

  • common-name:
    • a 5-taurinomethyl-2-thiouridine in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=TRNA-with-5-taurinomethyl-2-thiouridine&oldid=138302"