Difference between revisions of "LYS2-peptidyl-carrier-protein"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3725 == * common-name: ** uridine 2'3'-cyclic monophosphate * smiles: ** c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23))) * inchi-...")
(Created page with "Category:metabolite == Metabolite LYS2-peptidyl-carrier-protein == * common-name: ** an apo-[lys2 peptidyl-carrier-protein] == Reaction(s) known to consume the compound ==...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3725 ==
+
== Metabolite LYS2-peptidyl-carrier-protein ==
 
* common-name:
 
* common-name:
** uridine 2'3'-cyclic monophosphate
+
** an apo-[lys2 peptidyl-carrier-protein]
* smiles:
 
** c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23)))
 
* inchi-key:
 
** hwdmhjdymfrxox-xvfcmesisa-m
 
* molecular-weight:
 
** 305.16
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12060]]
+
* [[RXN-16759]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16759]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=uridine 2'3'-cyclic monophosphate}}
+
{{#set: common-name=an apo-[lys2 peptidyl-carrier-protein]}}
{{#set: inchi-key=inchikey=hwdmhjdymfrxox-xvfcmesisa-m}}
 
{{#set: molecular-weight=305.16}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite LYS2-peptidyl-carrier-protein

  • common-name:
    • an apo-[lys2 peptidyl-carrier-protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an apo-[lys2 peptidyl-carrier-protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.