Difference between revisions of "Fe2-siderophores"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9925 == * common-name: ** 1,4-dihydroxy-2-naphthoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c2(c=c(o)c1(=cc=cc=c1c(o)=2)))=o)co...")
(Created page with "Category:metabolite == Metabolite Fe2-siderophores == * common-name: ** an fe(ii)-siderophore == Reaction(s) known to consume the compound == == Reaction(s) known to produ...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9925 ==
+
== Metabolite Fe2-siderophores ==
 
* common-name:
 
* common-name:
** 1,4-dihydroxy-2-naphthoyl-coa
+
** an fe(ii)-siderophore
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c2(c=c(o)c1(=cc=cc=c1c(o)=2)))=o)cop(=o)(op(=o)(occ3(c(op([o-])(=o)[o-])c(o)c(o3)n5(c4(=c(c(n)=nc=n4)n=c5))))[o-])[o-]
 
* inchi-key:
 
** pytinlgpkdjurz-hsjnekgzsa-j
 
* molecular-weight:
 
** 949.669
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NAPHTHOATE-SYN-RXN]]
+
* [[FERRIC-CHELATE-REDUCTASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1,4-dihydroxy-2-naphthoyl-coa}}
+
{{#set: common-name=an fe(ii)-siderophore}}
{{#set: inchi-key=inchikey=pytinlgpkdjurz-hsjnekgzsa-j}}
 
{{#set: molecular-weight=949.669}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Fe2-siderophores

  • common-name:
    • an fe(ii)-siderophore

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality