Difference between revisions of "CPD-14425"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite METHYLBUT-CPD == * common-name: ** 2-methylbutanal * smiles: ** ccc(c)[ch]=o * inchi-key: ** bygqbdhughbgmd-uhfffaoysa-n * molecular-weig...")
(Created page with "Category:metabolite == Metabolite CPD-14425 == * common-name: ** (2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite METHYLBUT-CPD ==
+
== Metabolite CPD-14425 ==
 
* common-name:
 
* common-name:
** 2-methylbutanal
+
** (2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa
 
* smiles:
 
* smiles:
** ccc(c)[ch]=o
+
** ccc=ccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** bygqbdhughbgmd-uhfffaoysa-n
+
** hgvxutaezaltig-hkhrklhhsa-j
 
* molecular-weight:
 
* molecular-weight:
** 86.133
+
** 1073.981
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7694]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13444]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methylbutanal}}
+
{{#set: common-name=(2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa}}
{{#set: inchi-key=inchikey=bygqbdhughbgmd-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=hgvxutaezaltig-hkhrklhhsa-j}}
{{#set: molecular-weight=86.133}}
+
{{#set: molecular-weight=1073.981}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-14425

  • common-name:
    • (2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • hgvxutaezaltig-hkhrklhhsa-j
  • molecular-weight:
    • 1073.981

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality