Difference between revisions of "CPDQT-40"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-Phospho-RNA == * common-name: ** a 5'-phospho-ribonucleoside-[rna] == Reaction(s) known to consume the compound == * RNA-LIGASE-ATP-R...")
(Created page with "Category:metabolite == Metabolite CPDQT-40 == * common-name: ** 3-[(7'-methylthio)heptyl]malate * smiles: ** cscccccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** sxljfgxgvbw...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-Phospho-RNA ==
+
== Metabolite CPDQT-40 ==
 
* common-name:
 
* common-name:
** a 5'-phospho-ribonucleoside-[rna]
+
** 3-[(7'-methylthio)heptyl]malate
 +
* smiles:
 +
** cscccccccc(c(o)c(=o)[o-])c(=o)[o-]
 +
* inchi-key:
 +
** sxljfgxgvbwoob-uhfffaoysa-l
 +
* molecular-weight:
 +
** 276.347
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RNA-LIGASE-ATP-RXN]]
+
* [[RXN-18200]]
* [[RXN-17926]]
+
* [[RXNQT-4178]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-18200]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5'-phospho-ribonucleoside-[rna]}}
+
{{#set: common-name=3-[(7'-methylthio)heptyl]malate}}
 +
{{#set: inchi-key=inchikey=sxljfgxgvbwoob-uhfffaoysa-l}}
 +
{{#set: molecular-weight=276.347}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPDQT-40

  • common-name:
    • 3-[(7'-methylthio)heptyl]malate
  • smiles:
    • cscccccccc(c(o)c(=o)[o-])c(=o)[o-]
  • inchi-key:
    • sxljfgxgvbwoob-uhfffaoysa-l
  • molecular-weight:
    • 276.347

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "3-[(7'-methylthio)heptyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.