Difference between revisions of "CPD-22766"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14115 == * common-name: ** (s)-equol * smiles: ** c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o) * inchi-key: ** adfcqwzhkcxpaj-gfccveg...") |
(Created page with "Category:metabolite == Metabolite CPD-22766 == == Reaction(s) known to consume the compound == * RXN21167 == Reaction(s) known to produce the compound == * [[RXN21166]...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-22766 == |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN21167]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN21166]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− |