Difference between revisions of "CPD-22766"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14115 == * common-name: ** (s)-equol * smiles: ** c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o) * inchi-key: ** adfcqwzhkcxpaj-gfccveg...")
(Created page with "Category:metabolite == Metabolite CPD-22766 == == Reaction(s) known to consume the compound == * RXN21167 == Reaction(s) known to produce the compound == * [[RXN21166]...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14115 ==
+
== Metabolite CPD-22766 ==
* common-name:
 
** (s)-equol
 
* smiles:
 
** c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o)
 
* inchi-key:
 
** adfcqwzhkcxpaj-gfccvegcsa-n
 
* molecular-weight:
 
** 242.274
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15589]]
+
* [[RXN21167]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15589]]
+
* [[RXN21166]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-equol}}
 
{{#set: inchi-key=inchikey=adfcqwzhkcxpaj-gfccvegcsa-n}}
 
{{#set: molecular-weight=242.274}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-22766

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality